C32H52F2O3 — CID 67843593
1-cyclohexyl-1-pentylcyclohexane;2,3-difluoro-4-octoxybenzoic acid (PubChem CID 67843593) has the molecular formula C32H52F2O3 and a molecular weight of 522.76 g/mol. Its IUPAC name is 1-cyclohexyl-1-pentylcyclohexane;2,3-difluoro-4-octoxybenzoic acid.
| Compound Name | 1-cyclohexyl-1-pentylcyclohexane;2,3-difluoro-4-octoxybenzoic acid |
|---|---|
| PubChem CID | 67843593 |
| Molecular Formula | C32H52F2O3 |
| Molecular Weight | 522.76 g/mol |
| Exact Mass | 522.39 |
| IUPAC Name | 1-cyclohexyl-1-pentylcyclohexane;2,3-difluoro-4-octoxybenzoic acid |
| SMILES | CCCCCC1(C2CCCCC2)CCCCC1.CCCCCCCCOc1ccc(C(=O)O)c(F)c1F |
| InChI | InChI=1S/C17H32.C15H20F2O3/c1-2-3-8-13-17(14-9-5-10-15-17)16-11-6-4-7-12-16;1-2-3-4-5-6-7-10-20-12-9-8-11(15(18)19)13(16)14(12)17/h16H,2-15H2,1H3;8-9H,2-7,10H2,1H3,(H,18,19) |
| InChIKey | DCZCRKMLZAETHD-UHFFFAOYSA-N |
| XLogP | 10.50 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.76 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|