C39H51F3O4 — CID 67899323
2-(4-decoxy-2,3-difluorophenyl)-4-(4-decoxy-3-fluorophenyl)benzoic acid (PubChem CID 67899323) has the molecular formula C39H51F3O4 and a molecular weight of 640.83 g/mol. Its IUPAC name is 2-(4-decoxy-2,3-difluorophenyl)-4-(4-decoxy-3-fluorophenyl)benzoic acid.
| Compound Name | 2-(4-decoxy-2,3-difluorophenyl)-4-(4-decoxy-3-fluorophenyl)benzoic acid |
|---|---|
| PubChem CID | 67899323 |
| Molecular Formula | C39H51F3O4 |
| Molecular Weight | 640.83 g/mol |
| Exact Mass | 640.37 |
| IUPAC Name | 2-(4-decoxy-2,3-difluorophenyl)-4-(4-decoxy-3-fluorophenyl)benzoic acid |
| SMILES | CCCCCCCCCCOc1ccc(-c2ccc(C(=O)O)c(-c3ccc(OCCCCCCCCCC)c(F)c3F)c2)cc1F |
| InChI | InChI=1S/C39H51F3O4/c1-3-5-7-9-11-13-15-17-25-45-35-23-20-30(28-34(35)40)29-19-21-32(39(43)44)33(27-29)31-22-24-36(38(42)37(31)41)46-26-18-16-14-12-10-8-6-4-2/h19-24,27-28H,3-18,25-26H2,1-2H3,(H,43,44) |
| InChIKey | KTPPNXIPLDFAFV-UHFFFAOYSA-N |
| XLogP | 12.18 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.83 |
| LogP ≤ 5 | 12.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|