C33H40F2O4 — CID 57289455
octyl 2-fluoro-3-(3-fluoro-4-hexoxyphenyl)-4-phenylbenzenecarboperoxoate (PubChem CID 57289455) has the molecular formula C33H40F2O4 and a molecular weight of 538.68 g/mol. Its IUPAC name is octyl 2-fluoro-3-(3-fluoro-4-hexoxyphenyl)-4-phenylbenzenecarboperoxoate.
| Compound Name | octyl 2-fluoro-3-(3-fluoro-4-hexoxyphenyl)-4-phenylbenzenecarboperoxoate |
|---|---|
| PubChem CID | 57289455 |
| Molecular Formula | C33H40F2O4 |
| Molecular Weight | 538.68 g/mol |
| Exact Mass | 538.29 |
| IUPAC Name | octyl 2-fluoro-3-(3-fluoro-4-hexoxyphenyl)-4-phenylbenzenecarboperoxoate |
| SMILES | CCCCCCCCOOC(=O)c1ccc(-c2ccccc2)c(-c2ccc(OCCCCCC)c(F)c2)c1F |
| InChI | InChI=1S/C33H40F2O4/c1-3-5-7-9-10-15-23-38-39-33(36)28-20-19-27(25-16-12-11-13-17-25)31(32(28)35)26-18-21-30(29(34)24-26)37-22-14-8-6-4-2/h11-13,16-21,24H,3-10,14-15,22-23H2,1-2H3 |
| InChIKey | NUHRITLPEIDPMQ-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.68 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|