C20H24BF3O3 — CID 58671908
[2,3-difluoro-4-(3-fluoro-4-octoxyphenyl)phenyl]boronic acid (PubChem CID 58671908) has the molecular formula C20H24BF3O3 and a molecular weight of 380.22 g/mol. Its IUPAC name is [2,3-difluoro-4-(3-fluoro-4-octoxyphenyl)phenyl]boronic acid.
| Compound Name | [2,3-difluoro-4-(3-fluoro-4-octoxyphenyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 58671908 |
| Molecular Formula | C20H24BF3O3 |
| Molecular Weight | 380.22 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | [2,3-difluoro-4-(3-fluoro-4-octoxyphenyl)phenyl]boronic acid |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(B(O)O)c(F)c2F)cc1F |
| InChI | InChI=1S/C20H24BF3O3/c1-2-3-4-5-6-7-12-27-18-11-8-14(13-17(18)22)15-9-10-16(21(25)26)20(24)19(15)23/h8-11,13,25-26H,2-7,12H2,1H3 |
| InChIKey | LWLQOSPTDVFOIY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.22 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|