C32H37F5O — CID 101067968
1-(1,1-difluorohexyl)-2,3-difluoro-4-[4-(3-fluoro-4-octoxyphenyl)phenyl]benzene (PubChem CID 101067968) has the molecular formula C32H37F5O and a molecular weight of 532.64 g/mol. Its IUPAC name is 1-(1,1-difluorohexyl)-2,3-difluoro-4-[4-(3-fluoro-4-octoxyphenyl)phenyl]benzene.
| Compound Name | 1-(1,1-difluorohexyl)-2,3-difluoro-4-[4-(3-fluoro-4-octoxyphenyl)phenyl]benzene |
|---|---|
| PubChem CID | 101067968 |
| Molecular Formula | C32H37F5O |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | 1-(1,1-difluorohexyl)-2,3-difluoro-4-[4-(3-fluoro-4-octoxyphenyl)phenyl]benzene |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(-c3ccc(C(F)(F)CCCCC)c(F)c3F)cc2)cc1F |
| InChI | InChI=1S/C32H37F5O/c1-3-5-7-8-9-11-21-38-29-19-16-25(22-28(29)33)23-12-14-24(15-13-23)26-17-18-27(31(35)30(26)34)32(36,37)20-10-6-4-2/h12-19,22H,3-11,20-21H2,1-2H3 |
| InChIKey | ZWSMOXHQVCAJSJ-UHFFFAOYSA-N |
| XLogP | 10.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|