C30H34F4O — CID 101067965
1-(1,1-difluorohexyl)-2,3-difluoro-4-[4-(4-hexoxyphenyl)phenyl]benzene (PubChem CID 101067965) has the molecular formula C30H34F4O and a molecular weight of 486.59 g/mol. Its IUPAC name is 1-(1,1-difluorohexyl)-2,3-difluoro-4-[4-(4-hexoxyphenyl)phenyl]benzene.
| Compound Name | 1-(1,1-difluorohexyl)-2,3-difluoro-4-[4-(4-hexoxyphenyl)phenyl]benzene |
|---|---|
| PubChem CID | 101067965 |
| Molecular Formula | C30H34F4O |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | 1-(1,1-difluorohexyl)-2,3-difluoro-4-[4-(4-hexoxyphenyl)phenyl]benzene |
| SMILES | CCCCCCOc1ccc(-c2ccc(-c3ccc(C(F)(F)CCCCC)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C30H34F4O/c1-3-5-7-9-21-35-25-16-14-23(15-17-25)22-10-12-24(13-11-22)26-18-19-27(29(32)28(26)31)30(33,34)20-8-6-4-2/h10-19H,3-9,20-21H2,1-2H3 |
| InChIKey | VBKHGQQZPXTOQJ-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|