About 1-(1,1-difluorohexyl)-2,3-difluoro-4-[4-(4-hexoxyphenyl)phenyl]benzene
1-(1,1-difluorohexyl)-2,3-difluoro-4-[4-(4-hexoxyphenyl)phenyl]benzene (PubChem CID 101067965) has the molecular formula C30H34F4O
and a molecular weight of 486.59 g/mol. Its IUPAC name is 1-(1,1-difluorohexyl)-2,3-difluoro-4-[4-(4-hexoxyphenyl)phenyl]benzene.
Molecular Properties
| Compound Name | 1-(1,1-difluorohexyl)-2,3-difluoro-4-[4-(4-hexoxyphenyl)phenyl]benzene |
| PubChem CID | 101067965 |
| Molecular Formula | C30H34F4O |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | 1-(1,1-difluorohexyl)-2,3-difluoro-4-[4-(4-hexoxyphenyl)phenyl]benzene |
| SMILES | CCCCCCOc1ccc(-c2ccc(-c3ccc(C(F)(F)CCCCC)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C30H34F4O/c1-3-5-7-9-21-35-25-16-14-23(15-17-25)22-10-12-24(13-11-22)26-18-19-27(29(32)28(26)31)30(33,34)20-8-6-4-2/h10-19H,3-9,20-21H2,1-2H3 |
| InChIKey | VBKHGQQZPXTOQJ-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,1-difluorohexyl)-2,3-difluoro-4-[4-(4-hexoxyphenyl)phenyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,1-difluorohexyl)-2,3-difluoro-4-[4-(4-hexoxyphenyl)phenyl]benzene?
The IUPAC name of 1-(1,1-difluorohexyl)-2,3-difluoro-4-[4-(4-hexoxyphenyl)phenyl]benzene (CID 101067965) is 1-(1,1-difluorohexyl)-2,3-difluoro-4-[4-(4-hexoxyphenyl)phenyl]benzene.
What is the SMILES notation for 1-(1,1-difluorohexyl)-2,3-difluoro-4-[4-(4-hexoxyphenyl)phenyl]benzene?
The canonical SMILES for 1-(1,1-difluorohexyl)-2,3-difluoro-4-[4-(4-hexoxyphenyl)phenyl]benzene is CCCCCCOc1ccc(-c2ccc(-c3ccc(C(F)(F)CCCCC)c(F)c3F)cc2)cc1.
What is the InChIKey of 1-(1,1-difluorohexyl)-2,3-difluoro-4-[4-(4-hexoxyphenyl)phenyl]benzene?
The InChIKey is VBKHGQQZPXTOQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H34F4O/c1-3-5-7-9-21-35-25-16-14-23(15-17-25)22-10-12-24(13-11-22)26-18-19-27(29(32)28(26)31)30(33,34)20-8-6-4-2/h10-19H,3-9,20-21H2,1-2H3.
What are the key properties of 1-(1,1-difluorohexyl)-2,3-difluoro-4-[4-(4-hexoxyphenyl)phenyl]benzene?
1-(1,1-difluorohexyl)-2,3-difluoro-4-[4-(4-hexoxyphenyl)phenyl]benzene has a molecular weight of 486.59 g/mol, XLogP of 9.93, 13 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1-difluorohexyl)-2,3-difluoro-4-[4-(4-hexoxyphenyl)phenyl]benzene is sourced from PubChem (CID 101067965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).