C28H31F11O2 — CID 87738995
2,3-difluoro-1-[4-(5,5,6,6,7,7,8,8,8-nonafluorooctoxy)phenyl]-4-octoxybenzene (PubChem CID 87738995) has the molecular formula C28H31F11O2 and a molecular weight of 608.53 g/mol. Its IUPAC name is 2,3-difluoro-1-[4-(5,5,6,6,7,7,8,8,8-nonafluorooctoxy)phenyl]-4-octoxybenzene.
| Compound Name | 2,3-difluoro-1-[4-(5,5,6,6,7,7,8,8,8-nonafluorooctoxy)phenyl]-4-octoxybenzene |
|---|---|
| PubChem CID | 87738995 |
| Molecular Formula | C28H31F11O2 |
| Molecular Weight | 608.53 g/mol |
| Exact Mass | 608.21 |
| IUPAC Name | 2,3-difluoro-1-[4-(5,5,6,6,7,7,8,8,8-nonafluorooctoxy)phenyl]-4-octoxybenzene |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(OCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc2)c(F)c1F |
| InChI | InChI=1S/C28H31F11O2/c1-2-3-4-5-6-8-18-41-22-15-14-21(23(29)24(22)30)19-10-12-20(13-11-19)40-17-9-7-16-25(31,32)26(33,34)27(35,36)28(37,38)39/h10-15H,2-9,16-18H2,1H3 |
| InChIKey | QZPJEVPHPQEDMA-UHFFFAOYSA-N |
| XLogP | 10.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.53 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|