C34H42F4O — CID 21335708
1-(2,2-difluorooctyl)-2,3-difluoro-4-[4-(4-octoxyphenyl)phenyl]benzene (PubChem CID 21335708) has the molecular formula C34H42F4O and a molecular weight of 542.70 g/mol. Its IUPAC name is 1-(2,2-difluorooctyl)-2,3-difluoro-4-[4-(4-octoxyphenyl)phenyl]benzene.
| Compound Name | 1-(2,2-difluorooctyl)-2,3-difluoro-4-[4-(4-octoxyphenyl)phenyl]benzene |
|---|---|
| PubChem CID | 21335708 |
| Molecular Formula | C34H42F4O |
| Molecular Weight | 542.70 g/mol |
| Exact Mass | 542.32 |
| IUPAC Name | 1-(2,2-difluorooctyl)-2,3-difluoro-4-[4-(4-octoxyphenyl)phenyl]benzene |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(-c3ccc(CC(F)(F)CCCCCC)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C34H42F4O/c1-3-5-7-9-10-12-24-39-30-20-17-27(18-21-30)26-13-15-28(16-14-26)31-22-19-29(32(35)33(31)36)25-34(37,38)23-11-8-6-4-2/h13-22H,3-12,23-25H2,1-2H3 |
| InChIKey | UHTGBIVUVDSCJA-UHFFFAOYSA-N |
| XLogP | 11.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.70 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|