C29H28F8 — CID 162548208
1-(2,2-difluorooctyl)-4-[4-[4-(2,2-difluoropropyl)-2,3-difluorophenyl]phenyl]-2,3-difluorobenzene (PubChem CID 162548208) has the molecular formula C29H28F8 and a molecular weight of 528.53 g/mol. Its IUPAC name is 1-(2,2-difluorooctyl)-4-[4-[4-(2,2-difluoropropyl)-2,3-difluorophenyl]phenyl]-2,3-difluorobenzene.
| Compound Name | 1-(2,2-difluorooctyl)-4-[4-[4-(2,2-difluoropropyl)-2,3-difluorophenyl]phenyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 162548208 |
| Molecular Formula | C29H28F8 |
| Molecular Weight | 528.53 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | 1-(2,2-difluorooctyl)-4-[4-[4-(2,2-difluoropropyl)-2,3-difluorophenyl]phenyl]-2,3-difluorobenzene |
| SMILES | CCCCCCC(F)(F)Cc1ccc(-c2ccc(-c3ccc(CC(C)(F)F)c(F)c3F)cc2)c(F)c1F |
| InChI | InChI=1S/C29H28F8/c1-3-4-5-6-15-29(36,37)17-21-12-14-23(27(33)25(21)31)19-9-7-18(8-10-19)22-13-11-20(16-28(2,34)35)24(30)26(22)32/h7-14H,3-6,15-17H2,1-2H3 |
| InChIKey | MBMLDZMJIZDBTC-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.53 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|