C31H38F3NO — CID 54306527
3-(1,1-difluorohexyl)-2-fluoro-6-[4-(4-octoxyphenyl)phenyl]pyridine (PubChem CID 54306527) has the molecular formula C31H38F3NO and a molecular weight of 497.65 g/mol. Its IUPAC name is 3-(1,1-difluorohexyl)-2-fluoro-6-[4-(4-octoxyphenyl)phenyl]pyridine.
| Compound Name | 3-(1,1-difluorohexyl)-2-fluoro-6-[4-(4-octoxyphenyl)phenyl]pyridine |
|---|---|
| PubChem CID | 54306527 |
| Molecular Formula | C31H38F3NO |
| Molecular Weight | 497.65 g/mol |
| Exact Mass | 497.29 |
| IUPAC Name | 3-(1,1-difluorohexyl)-2-fluoro-6-[4-(4-octoxyphenyl)phenyl]pyridine |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(-c3ccc(C(F)(F)CCCCC)c(F)n3)cc2)cc1 |
| InChI | InChI=1S/C31H38F3NO/c1-3-5-7-8-9-11-23-36-27-18-16-25(17-19-27)24-12-14-26(15-13-24)29-21-20-28(30(32)35-29)31(33,34)22-10-6-4-2/h12-21H,3-11,22-23H2,1-2H3 |
| InChIKey | SHXNULDOASJSKS-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.65 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|