C29H41F3O2 — CID 139992979
1-octoxy-4-(4-octoxyphenyl)-2-(trifluoromethyl)benzene (PubChem CID 139992979) has the molecular formula C29H41F3O2 and a molecular weight of 478.64 g/mol. Its IUPAC name is 1-octoxy-4-(4-octoxyphenyl)-2-(trifluoromethyl)benzene.
| Compound Name | 1-octoxy-4-(4-octoxyphenyl)-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 139992979 |
| Molecular Formula | C29H41F3O2 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.31 |
| IUPAC Name | 1-octoxy-4-(4-octoxyphenyl)-2-(trifluoromethyl)benzene |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(OCCCCCCCC)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C29H41F3O2/c1-3-5-7-9-11-13-21-33-26-18-15-24(16-19-26)25-17-20-28(27(23-25)29(30,31)32)34-22-14-12-10-8-6-4-2/h15-20,23H,3-14,21-22H2,1-2H3 |
| InChIKey | ONXLAJQDJUYLBO-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|