C19H26F2O3 — CID 172723761
1-(2,3-difluoro-4-hexoxyphenyl)cyclohexane-1-carboxylic acid (PubChem CID 172723761) has the molecular formula C19H26F2O3 and a molecular weight of 340.41 g/mol. Its IUPAC name is 1-(2,3-difluoro-4-hexoxyphenyl)cyclohexane-1-carboxylic acid.
| Compound Name | 1-(2,3-difluoro-4-hexoxyphenyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 172723761 |
| Molecular Formula | C19H26F2O3 |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 1-(2,3-difluoro-4-hexoxyphenyl)cyclohexane-1-carboxylic acid |
| SMILES | CCCCCCOc1ccc(C2(C(=O)O)CCCCC2)c(F)c1F |
| InChI | InChI=1S/C19H26F2O3/c1-2-3-4-8-13-24-15-10-9-14(16(20)17(15)21)19(18(22)23)11-6-5-7-12-19/h9-10H,2-8,11-13H2,1H3,(H,22,23) |
| InChIKey | GWDQDXBXHNGTGI-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|