C26H28F2N2O4 — CID 59928940
[4-(2-octoxypyrimidin-5-yl)phenyl] 2,3-difluoro-4-methoxybenzoate (PubChem CID 59928940) has the molecular formula C26H28F2N2O4 and a molecular weight of 470.52 g/mol. Its IUPAC name is [4-(2-octoxypyrimidin-5-yl)phenyl] 2,3-difluoro-4-methoxybenzoate.
| Compound Name | [4-(2-octoxypyrimidin-5-yl)phenyl] 2,3-difluoro-4-methoxybenzoate |
|---|---|
| PubChem CID | 59928940 |
| Molecular Formula | C26H28F2N2O4 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | [4-(2-octoxypyrimidin-5-yl)phenyl] 2,3-difluoro-4-methoxybenzoate |
| SMILES | CCCCCCCCOc1ncc(-c2ccc(OC(=O)c3ccc(OC)c(F)c3F)cc2)cn1 |
| InChI | InChI=1S/C26H28F2N2O4/c1-3-4-5-6-7-8-15-33-26-29-16-19(17-30-26)18-9-11-20(12-10-18)34-25(31)21-13-14-22(32-2)24(28)23(21)27/h9-14,16-17H,3-8,15H2,1-2H3 |
| InChIKey | MTLFSTUIPYGDJF-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|