C26H36N2O5 — CID 14669862
[4-(2-octoxypyrimidin-5-yl)phenyl] (4R,5R)-5-ethyl-2,2-dimethyl-1,3-dioxolane-4-carboxylate (PubChem CID 14669862) has the molecular formula C26H36N2O5 and a molecular weight of 456.58 g/mol. Its IUPAC name is [4-(2-octoxypyrimidin-5-yl)phenyl] (4R,5R)-5-ethyl-2,2-dimethyl-1,3-dioxolane-4-carboxylate.
| Compound Name | [4-(2-octoxypyrimidin-5-yl)phenyl] (4R,5R)-5-ethyl-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 14669862 |
| Molecular Formula | C26H36N2O5 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | [4-(2-octoxypyrimidin-5-yl)phenyl] (4R,5R)-5-ethyl-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
| SMILES | CCCCCCCCOc1ncc(-c2ccc(OC(=O)[C@@H]3OC(C)(C)O[C@@H]3CC)cc2)cn1 |
| InChI | InChI=1S/C26H36N2O5/c1-5-7-8-9-10-11-16-30-25-27-17-20(18-28-25)19-12-14-21(15-13-19)31-24(29)23-22(6-2)32-26(3,4)33-23/h12-15,17-18,22-23H,5-11,16H2,1-4H3/t22-,23-/m1/s1 |
| InChIKey | CJHZSGRPOAGNFL-DHIUTWEWSA-N |
| XLogP | 5.72 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|