C28H32N2O4 — CID 19039019
[4-[5-(4-hexylphenyl)pyrimidin-2-yl]phenyl] 2,2-dimethyl-1,3-dioxolane-4-carboxylate (PubChem CID 19039019) has the molecular formula C28H32N2O4 and a molecular weight of 460.57 g/mol. Its IUPAC name is [4-[5-(4-hexylphenyl)pyrimidin-2-yl]phenyl] 2,2-dimethyl-1,3-dioxolane-4-carboxylate.
| Compound Name | [4-[5-(4-hexylphenyl)pyrimidin-2-yl]phenyl] 2,2-dimethyl-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 19039019 |
| Molecular Formula | C28H32N2O4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | [4-[5-(4-hexylphenyl)pyrimidin-2-yl]phenyl] 2,2-dimethyl-1,3-dioxolane-4-carboxylate |
| SMILES | CCCCCCc1ccc(-c2cnc(-c3ccc(OC(=O)C4COC(C)(C)O4)cc3)nc2)cc1 |
| InChI | InChI=1S/C28H32N2O4/c1-4-5-6-7-8-20-9-11-21(12-10-20)23-17-29-26(30-18-23)22-13-15-24(16-14-22)33-27(31)25-19-32-28(2,3)34-25/h9-18,25H,4-8,19H2,1-3H3 |
| InChIKey | UGLBQDFZLUOKBS-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|