C32H45N3O2 — CID 18644572
[4-(5-hexylpyrimidin-2-yl)phenyl] 4-cyano-4-octylcyclohexane-1-carboxylate (PubChem CID 18644572) has the molecular formula C32H45N3O2 and a molecular weight of 503.73 g/mol. Its IUPAC name is [4-(5-hexylpyrimidin-2-yl)phenyl] 4-cyano-4-octylcyclohexane-1-carboxylate.
| Compound Name | [4-(5-hexylpyrimidin-2-yl)phenyl] 4-cyano-4-octylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 18644572 |
| Molecular Formula | C32H45N3O2 |
| Molecular Weight | 503.73 g/mol |
| Exact Mass | 503.35 |
| IUPAC Name | [4-(5-hexylpyrimidin-2-yl)phenyl] 4-cyano-4-octylcyclohexane-1-carboxylate |
| SMILES | CCCCCCCCC1(C#N)CCC(C(=O)Oc2ccc(-c3ncc(CCCCCC)cn3)cc2)CC1 |
| InChI | InChI=1S/C32H45N3O2/c1-3-5-7-9-10-12-20-32(25-33)21-18-28(19-22-32)31(36)37-29-16-14-27(15-17-29)30-34-23-26(24-35-30)13-11-8-6-4-2/h14-17,23-24,28H,3-13,18-22H2,1-2H3 |
| InChIKey | CQVZVQMYPDRFGM-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 75.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.73 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|