C35H38N2O2 — CID 121385878
[4-(5-decylpyrimidin-2-yl)phenyl] 4-octa-1,3,5,7-tetraynylcyclohexane-1-carboxylate (PubChem CID 121385878) has the molecular formula C35H38N2O2 and a molecular weight of 518.70 g/mol. Its IUPAC name is [4-(5-decylpyrimidin-2-yl)phenyl] 4-octa-1,3,5,7-tetraynylcyclohexane-1-carboxylate.
| Compound Name | [4-(5-decylpyrimidin-2-yl)phenyl] 4-octa-1,3,5,7-tetraynylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 121385878 |
| Molecular Formula | C35H38N2O2 |
| Molecular Weight | 518.70 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | [4-(5-decylpyrimidin-2-yl)phenyl] 4-octa-1,3,5,7-tetraynylcyclohexane-1-carboxylate |
| SMILES | C#CC#CC#CC#CC1CCC(C(=O)Oc2ccc(-c3ncc(CCCCCCCCCC)cn3)cc2)CC1 |
| InChI | InChI=1S/C35H38N2O2/c1-3-5-7-9-11-12-14-16-18-30-27-36-34(37-28-30)31-23-25-33(26-24-31)39-35(38)32-21-19-29(20-22-32)17-15-13-10-8-6-4-2/h2,23-29,32H,3,5,7,9,11-12,14,16,18-22H2,1H3 |
| InChIKey | CKWKATSRTZDTFP-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.70 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|