C24H24N2O — CID 154606974
2-(4-hexa-1,3,5-triynoxyphenyl)-5-octylpyrimidine (PubChem CID 154606974) has the molecular formula C24H24N2O and a molecular weight of 356.47 g/mol. Its IUPAC name is 2-(4-hexa-1,3,5-triynoxyphenyl)-5-octylpyrimidine.
| Compound Name | 2-(4-hexa-1,3,5-triynoxyphenyl)-5-octylpyrimidine |
|---|---|
| PubChem CID | 154606974 |
| Molecular Formula | C24H24N2O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | 2-(4-hexa-1,3,5-triynoxyphenyl)-5-octylpyrimidine |
| SMILES | C#CC#CC#COc1ccc(-c2ncc(CCCCCCCC)cn2)cc1 |
| InChI | InChI=1S/C24H24N2O/c1-3-5-7-9-10-11-13-21-19-25-24(26-20-21)22-14-16-23(17-15-22)27-18-12-8-6-4-2/h2,14-17,19-20H,3,5,7,9-11,13H2,1H3 |
| InChIKey | QSIWKHKIOJCBRI-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|