C29H41NO2 — CID 54344076
[4-(5-octyl-2-pyridinyl)phenyl] 4-propylcyclohexane-1-carboxylate (PubChem CID 54344076) has the molecular formula C29H41NO2 and a molecular weight of 435.65 g/mol. Its IUPAC name is [4-(5-octyl-2-pyridinyl)phenyl] 4-propylcyclohexane-1-carboxylate.
| Compound Name | [4-(5-octyl-2-pyridinyl)phenyl] 4-propylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 54344076 |
| Molecular Formula | C29H41NO2 |
| Molecular Weight | 435.65 g/mol |
| Exact Mass | 435.31 |
| IUPAC Name | [4-(5-octyl-2-pyridinyl)phenyl] 4-propylcyclohexane-1-carboxylate |
| SMILES | CCCCCCCCc1ccc(-c2ccc(OC(=O)C3CCC(CCC)CC3)cc2)nc1 |
| InChI | InChI=1S/C29H41NO2/c1-3-5-6-7-8-9-11-24-14-21-28(30-22-24)25-17-19-27(20-18-25)32-29(31)26-15-12-23(10-4-2)13-16-26/h14,17-23,26H,3-13,15-16H2,1-2H3 |
| InChIKey | UBAWOOZLIYVYMR-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.65 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|