C32H44N2O2 — CID 18644538
[4-(5-butyl-2-pyridinyl)phenyl] 4-cyano-4-nonylcyclohexane-1-carboxylate (PubChem CID 18644538) has the molecular formula C32H44N2O2 and a molecular weight of 488.72 g/mol. Its IUPAC name is [4-(5-butyl-2-pyridinyl)phenyl] 4-cyano-4-nonylcyclohexane-1-carboxylate.
| Compound Name | [4-(5-butyl-2-pyridinyl)phenyl] 4-cyano-4-nonylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 18644538 |
| Molecular Formula | C32H44N2O2 |
| Molecular Weight | 488.72 g/mol |
| Exact Mass | 488.34 |
| IUPAC Name | [4-(5-butyl-2-pyridinyl)phenyl] 4-cyano-4-nonylcyclohexane-1-carboxylate |
| SMILES | CCCCCCCCCC1(C#N)CCC(C(=O)Oc2ccc(-c3ccc(CCCC)cn3)cc2)CC1 |
| InChI | InChI=1S/C32H44N2O2/c1-3-5-7-8-9-10-11-21-32(25-33)22-19-28(20-23-32)31(35)36-29-16-14-27(15-17-29)30-18-13-26(24-34-30)12-6-4-2/h13-18,24,28H,3-12,19-23H2,1-2H3 |
| InChIKey | XSPIKQSIPTZCIN-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.72 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|