C35H51N3O2 — CID 19979876
(4-cyano-4-heptylcyclohexyl) 4-(5-decylpyrimidin-2-yl)benzoate (PubChem CID 19979876) has the molecular formula C35H51N3O2 and a molecular weight of 545.81 g/mol. Its IUPAC name is (4-cyano-4-heptylcyclohexyl) 4-(5-decylpyrimidin-2-yl)benzoate.
| Compound Name | (4-cyano-4-heptylcyclohexyl) 4-(5-decylpyrimidin-2-yl)benzoate |
|---|---|
| PubChem CID | 19979876 |
| Molecular Formula | C35H51N3O2 |
| Molecular Weight | 545.81 g/mol |
| Exact Mass | 545.40 |
| IUPAC Name | (4-cyano-4-heptylcyclohexyl) 4-(5-decylpyrimidin-2-yl)benzoate |
| SMILES | CCCCCCCCCCc1cnc(-c2ccc(C(=O)OC3CCC(C#N)(CCCCCCC)CC3)cc2)nc1 |
| InChI | InChI=1S/C35H51N3O2/c1-3-5-7-9-10-11-12-14-16-29-26-37-33(38-27-29)30-17-19-31(20-18-30)34(39)40-32-21-24-35(28-36,25-22-32)23-15-13-8-6-4-2/h17-20,26-27,32H,3-16,21-25H2,1-2H3 |
| InChIKey | WNBUFVVGENCYFE-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 75.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.81 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|