C35H50N2O2 — CID 18644589
[4-(5-octyl-2-pyridinyl)phenyl] 4-cyano-4-octylcyclohexane-1-carboxylate (PubChem CID 18644589) has the molecular formula C35H50N2O2 and a molecular weight of 530.80 g/mol. Its IUPAC name is [4-(5-octyl-2-pyridinyl)phenyl] 4-cyano-4-octylcyclohexane-1-carboxylate.
| Compound Name | [4-(5-octyl-2-pyridinyl)phenyl] 4-cyano-4-octylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 18644589 |
| Molecular Formula | C35H50N2O2 |
| Molecular Weight | 530.80 g/mol |
| Exact Mass | 530.39 |
| IUPAC Name | [4-(5-octyl-2-pyridinyl)phenyl] 4-cyano-4-octylcyclohexane-1-carboxylate |
| SMILES | CCCCCCCCc1ccc(-c2ccc(OC(=O)C3CCC(C#N)(CCCCCCCC)CC3)cc2)nc1 |
| InChI | InChI=1S/C35H50N2O2/c1-3-5-7-9-11-13-15-29-16-21-33(37-27-29)30-17-19-32(20-18-30)39-34(38)31-22-25-35(28-36,26-23-31)24-14-12-10-8-6-4-2/h16-21,27,31H,3-15,22-26H2,1-2H3 |
| InChIKey | SNNFTIUZIPLDQO-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.80 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|