C30H42N2 — CID 54392547
4-[4-(5-hexyl-2-pyridinyl)phenyl]-1-[(3S)-3-methylpentyl]cyclohexane-1-carbonitrile (PubChem CID 54392547) has the molecular formula C30H42N2 and a molecular weight of 430.68 g/mol. Its IUPAC name is 4-[4-(5-hexyl-2-pyridinyl)phenyl]-1-[(3S)-3-methylpentyl]cyclohexane-1-carbonitrile.
| Compound Name | 4-[4-(5-hexyl-2-pyridinyl)phenyl]-1-[(3S)-3-methylpentyl]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 54392547 |
| Molecular Formula | C30H42N2 |
| Molecular Weight | 430.68 g/mol |
| Exact Mass | 430.33 |
| IUPAC Name | 4-[4-(5-hexyl-2-pyridinyl)phenyl]-1-[(3S)-3-methylpentyl]cyclohexane-1-carbonitrile |
| SMILES | CCCCCCc1ccc(-c2ccc(C3CCC(C#N)(CC[C@@H](C)CC)CC3)cc2)nc1 |
| InChI | InChI=1S/C30H42N2/c1-4-6-7-8-9-25-10-15-29(32-22-25)28-13-11-26(12-14-28)27-17-20-30(23-31,21-18-27)19-16-24(3)5-2/h10-15,22,24,27H,4-9,16-21H2,1-3H3/t24-,27?,30?/m0/s1 |
| InChIKey | VHRKMWPCZBKNPK-LMRVFMMHSA-N |
| XLogP | 8.87 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.68 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|