C34H49NO — CID 139882361
1-(3,7-dimethyloctyl)-4-[4-(4-pentoxyphenyl)phenyl]cyclohexane-1-carbonitrile (PubChem CID 139882361) has the molecular formula C34H49NO and a molecular weight of 487.77 g/mol. Its IUPAC name is 1-(3,7-dimethyloctyl)-4-[4-(4-pentoxyphenyl)phenyl]cyclohexane-1-carbonitrile.
| Compound Name | 1-(3,7-dimethyloctyl)-4-[4-(4-pentoxyphenyl)phenyl]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 139882361 |
| Molecular Formula | C34H49NO |
| Molecular Weight | 487.77 g/mol |
| Exact Mass | 487.38 |
| IUPAC Name | 1-(3,7-dimethyloctyl)-4-[4-(4-pentoxyphenyl)phenyl]cyclohexane-1-carbonitrile |
| SMILES | CCCCCOc1ccc(-c2ccc(C3CCC(C#N)(CCC(C)CCCC(C)C)CC3)cc2)cc1 |
| InChI | InChI=1S/C34H49NO/c1-5-6-7-25-36-33-17-15-31(16-18-33)29-11-13-30(14-12-29)32-20-23-34(26-35,24-21-32)22-19-28(4)10-8-9-27(2)3/h11-18,27-28,32H,5-10,19-25H2,1-4H3 |
| InChIKey | NUBOYOSRLUZVDR-UHFFFAOYSA-N |
| XLogP | 10.33 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.77 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|