C31H51NO — CID 139882493
4-[4-(3,7-dimethyloctoxy)phenyl]-1-octylcyclohexane-1-carbonitrile (PubChem CID 139882493) has the molecular formula C31H51NO and a molecular weight of 453.76 g/mol. Its IUPAC name is 4-[4-(3,7-dimethyloctoxy)phenyl]-1-octylcyclohexane-1-carbonitrile.
| Compound Name | 4-[4-(3,7-dimethyloctoxy)phenyl]-1-octylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 139882493 |
| Molecular Formula | C31H51NO |
| Molecular Weight | 453.76 g/mol |
| Exact Mass | 453.40 |
| IUPAC Name | 4-[4-(3,7-dimethyloctoxy)phenyl]-1-octylcyclohexane-1-carbonitrile |
| SMILES | CCCCCCCCC1(C#N)CCC(c2ccc(OCCC(C)CCCC(C)C)cc2)CC1 |
| InChI | InChI=1S/C31H51NO/c1-5-6-7-8-9-10-21-31(25-32)22-18-29(19-23-31)28-14-16-30(17-15-28)33-24-20-27(4)13-11-12-26(2)3/h14-17,26-27,29H,5-13,18-24H2,1-4H3 |
| InChIKey | IJEQCLFGDHVXMD-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.76 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|