C34H46ClNO2 — CID 88646114
[4-[4-(4-cyano-4-nonylcyclohexyl)phenyl]phenyl] 2-chloro-4-methylpentanoate (PubChem CID 88646114) has the molecular formula C34H46ClNO2 and a molecular weight of 536.20 g/mol. Its IUPAC name is [4-[4-(4-cyano-4-nonylcyclohexyl)phenyl]phenyl] 2-chloro-4-methylpentanoate.
| Compound Name | [4-[4-(4-cyano-4-nonylcyclohexyl)phenyl]phenyl] 2-chloro-4-methylpentanoate |
|---|---|
| PubChem CID | 88646114 |
| Molecular Formula | C34H46ClNO2 |
| Molecular Weight | 536.20 g/mol |
| Exact Mass | 535.32 |
| IUPAC Name | [4-[4-(4-cyano-4-nonylcyclohexyl)phenyl]phenyl] 2-chloro-4-methylpentanoate |
| SMILES | CCCCCCCCCC1(C#N)CCC(c2ccc(-c3ccc(OC(=O)C(Cl)CC(C)C)cc3)cc2)CC1 |
| InChI | InChI=1S/C34H46ClNO2/c1-4-5-6-7-8-9-10-21-34(25-36)22-19-30(20-23-34)28-13-11-27(12-14-28)29-15-17-31(18-16-29)38-33(37)32(35)24-26(2)3/h11-18,26,30,32H,4-10,19-24H2,1-3H3 |
| InChIKey | OOHWXRPSGTZSAK-UHFFFAOYSA-N |
| XLogP | 10.22 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.20 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|