C34H47F2NO — CID 142023839
4-[4-[4-[(2R,3R)-2,3-difluorooctoxy]phenyl]phenyl]-1-heptylcyclohexane-1-carbonitrile (PubChem CID 142023839) has the molecular formula C34H47F2NO and a molecular weight of 523.75 g/mol. Its IUPAC name is 4-[4-[4-[(2R,3R)-2,3-difluorooctoxy]phenyl]phenyl]-1-heptylcyclohexane-1-carbonitrile.
| Compound Name | 4-[4-[4-[(2R,3R)-2,3-difluorooctoxy]phenyl]phenyl]-1-heptylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 142023839 |
| Molecular Formula | C34H47F2NO |
| Molecular Weight | 523.75 g/mol |
| Exact Mass | 523.36 |
| IUPAC Name | 4-[4-[4-[(2R,3R)-2,3-difluorooctoxy]phenyl]phenyl]-1-heptylcyclohexane-1-carbonitrile |
| SMILES | CCCCCCCC1(C#N)CCC(c2ccc(-c3ccc(OC[C@@H](F)[C@H](F)CCCCC)cc3)cc2)CC1 |
| InChI | InChI=1S/C34H47F2NO/c1-3-5-7-8-10-22-34(26-37)23-20-30(21-24-34)28-14-12-27(13-15-28)29-16-18-31(19-17-29)38-25-33(36)32(35)11-9-6-4-2/h12-19,30,32-33H,3-11,20-25H2,1-2H3/t30?,32-,33-,34?/m1/s1 |
| InChIKey | DBUDPZDIXMNRFQ-HPHSVLIFSA-N |
| XLogP | 10.52 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.75 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|