C32H42ClNO3 — CID 139882294
1-[4-[4-(4-cyano-4-pentylcyclohexyl)phenyl]phenoxy]propan-2-yl 2-chloro-3-methylbutanoate (PubChem CID 139882294) has the molecular formula C32H42ClNO3 and a molecular weight of 524.15 g/mol. Its IUPAC name is 1-[4-[4-(4-cyano-4-pentylcyclohexyl)phenyl]phenoxy]propan-2-yl 2-chloro-3-methylbutanoate.
| Compound Name | 1-[4-[4-(4-cyano-4-pentylcyclohexyl)phenyl]phenoxy]propan-2-yl 2-chloro-3-methylbutanoate |
|---|---|
| PubChem CID | 139882294 |
| Molecular Formula | C32H42ClNO3 |
| Molecular Weight | 524.15 g/mol |
| Exact Mass | 523.29 |
| IUPAC Name | 1-[4-[4-(4-cyano-4-pentylcyclohexyl)phenyl]phenoxy]propan-2-yl 2-chloro-3-methylbutanoate |
| SMILES | CCCCCC1(C#N)CCC(c2ccc(-c3ccc(OCC(C)OC(=O)C(Cl)C(C)C)cc3)cc2)CC1 |
| InChI | InChI=1S/C32H42ClNO3/c1-5-6-7-18-32(22-34)19-16-28(17-20-32)26-10-8-25(9-11-26)27-12-14-29(15-13-27)36-21-24(4)37-31(35)30(33)23(2)3/h8-15,23-24,28,30H,5-7,16-21H2,1-4H3 |
| InChIKey | RTZGGPURVWMIBB-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.15 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|