C23H35NO — CID 19979900
4-[4-(2-methylbutoxy)phenyl]-1-(2-methylbutyl)cyclohexane-1-carbonitrile (PubChem CID 19979900) has the molecular formula C23H35NO and a molecular weight of 341.54 g/mol. Its IUPAC name is 4-[4-(2-methylbutoxy)phenyl]-1-(2-methylbutyl)cyclohexane-1-carbonitrile.
| Compound Name | 4-[4-(2-methylbutoxy)phenyl]-1-(2-methylbutyl)cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 19979900 |
| Molecular Formula | C23H35NO |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.27 |
| IUPAC Name | 4-[4-(2-methylbutoxy)phenyl]-1-(2-methylbutyl)cyclohexane-1-carbonitrile |
| SMILES | CCC(C)COc1ccc(C2CCC(C#N)(CC(C)CC)CC2)cc1 |
| InChI | InChI=1S/C23H35NO/c1-5-18(3)15-23(17-24)13-11-21(12-14-23)20-7-9-22(10-8-20)25-16-19(4)6-2/h7-10,18-19,21H,5-6,11-16H2,1-4H3 |
| InChIKey | YARSTSKYBPIIMT-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |