About 1-cyclohexyl-4-(2-methylbutoxy)benzene;ethane;formaldehyde
1-cyclohexyl-4-(2-methylbutoxy)benzene;ethane;formaldehyde (PubChem CID 171788366) has the molecular formula C28H58O2
and a molecular weight of 426.77 g/mol. Its IUPAC name is 1-cyclohexyl-4-(2-methylbutoxy)benzene;ethane;formaldehyde.
Molecular Properties
| Compound Name | 1-cyclohexyl-4-(2-methylbutoxy)benzene;ethane;formaldehyde |
| PubChem CID | 171788366 |
| Molecular Formula | C28H58O2 |
| Molecular Weight | 426.77 g/mol |
| Exact Mass | 426.44 |
| IUPAC Name | 1-cyclohexyl-4-(2-methylbutoxy)benzene;ethane;formaldehyde |
| SMILES | C=O.CC.CC.CC.CC.CC.CCC(C)COc1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C17H26O.5C2H6.CH2O/c1-3-14(2)13-18-17-11-9-16(10-12-17)15-7-5-4-6-8-15;6*1-2/h9-12,14-15H,3-8,13H2,1-2H3;5*1-2H3;1H2 |
| InChIKey | AKYHQWIUPRZEPK-UHFFFAOYSA-N |
| XLogP | 10.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.77 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclohexyl-4-(2-methylbutoxy)benzene;ethane;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-4-(2-methylbutoxy)benzene;ethane;formaldehyde?
The IUPAC name of 1-cyclohexyl-4-(2-methylbutoxy)benzene;ethane;formaldehyde (CID 171788366) is 1-cyclohexyl-4-(2-methylbutoxy)benzene;ethane;formaldehyde.
What is the SMILES notation for 1-cyclohexyl-4-(2-methylbutoxy)benzene;ethane;formaldehyde?
The canonical SMILES for 1-cyclohexyl-4-(2-methylbutoxy)benzene;ethane;formaldehyde is C=O.CC.CC.CC.CC.CC.CCC(C)COc1ccc(C2CCCCC2)cc1.
What is the InChIKey of 1-cyclohexyl-4-(2-methylbutoxy)benzene;ethane;formaldehyde?
The InChIKey is AKYHQWIUPRZEPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O.5C2H6.CH2O/c1-3-14(2)13-18-17-11-9-16(10-12-17)15-7-5-4-6-8-15;6*1-2/h9-12,14-15H,3-8,13H2,1-2H3;5*1-2H3;1H2.
What are the key properties of 1-cyclohexyl-4-(2-methylbutoxy)benzene;ethane;formaldehyde?
1-cyclohexyl-4-(2-methylbutoxy)benzene;ethane;formaldehyde has a molecular weight of 426.77 g/mol, XLogP of 10.11, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-4-(2-methylbutoxy)benzene;ethane;formaldehyde is sourced from PubChem (CID 171788366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).