C30H35ClO — CID 144549629
2-chloro-1-[4-[(2R)-2-methylbutoxy]phenyl]-4-[4-(4-methylcyclohexyl)phenyl]benzene (PubChem CID 144549629) has the molecular formula C30H35ClO and a molecular weight of 447.06 g/mol. Its IUPAC name is 2-chloro-1-[4-[(2R)-2-methylbutoxy]phenyl]-4-[4-(4-methylcyclohexyl)phenyl]benzene.
| Compound Name | 2-chloro-1-[4-[(2R)-2-methylbutoxy]phenyl]-4-[4-(4-methylcyclohexyl)phenyl]benzene |
|---|---|
| PubChem CID | 144549629 |
| Molecular Formula | C30H35ClO |
| Molecular Weight | 447.06 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | 2-chloro-1-[4-[(2R)-2-methylbutoxy]phenyl]-4-[4-(4-methylcyclohexyl)phenyl]benzene |
| SMILES | CC[C@@H](C)COc1ccc(-c2ccc(-c3ccc(C4CCC(C)CC4)cc3)cc2Cl)cc1 |
| InChI | InChI=1S/C30H35ClO/c1-4-21(2)20-32-28-16-13-26(14-17-28)29-18-15-27(19-30(29)31)25-11-9-24(10-12-25)23-7-5-22(3)6-8-23/h9-19,21-23H,4-8,20H2,1-3H3/t21-,22?,23?/m1/s1 |
| InChIKey | RQKILYWYCJESHD-DDRJZQQSSA-N |
| XLogP | 9.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.06 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |