C31H34O3 — CID 144549609
acetylene;methyl 2-[4-[2-methyl-4-[4-(4-methylcyclohexyl)phenyl]phenyl]phenoxy]acetate (PubChem CID 144549609) has the molecular formula C31H34O3 and a molecular weight of 454.61 g/mol. Its IUPAC name is acetylene;methyl 2-[4-[2-methyl-4-[4-(4-methylcyclohexyl)phenyl]phenyl]phenoxy]acetate.
| Compound Name | acetylene;methyl 2-[4-[2-methyl-4-[4-(4-methylcyclohexyl)phenyl]phenyl]phenoxy]acetate |
|---|---|
| PubChem CID | 144549609 |
| Molecular Formula | C31H34O3 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | acetylene;methyl 2-[4-[2-methyl-4-[4-(4-methylcyclohexyl)phenyl]phenyl]phenoxy]acetate |
| SMILES | C#C.COC(=O)COc1ccc(-c2ccc(-c3ccc(C4CCC(C)CC4)cc3)cc2C)cc1 |
| InChI | InChI=1S/C29H32O3.C2H2/c1-20-4-6-22(7-5-20)23-8-10-24(11-9-23)26-14-17-28(21(2)18-26)25-12-15-27(16-13-25)32-19-29(30)31-3;1-2/h8-18,20,22H,4-7,19H2,1-3H3;1-2H |
| InChIKey | VZHWHKSJXJEHRC-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|