C24H26O4 — CID 121338868
[4-(4-methylcyclohexyl)phenyl] 4-(2-oxobut-3-enoxy)benzoate (PubChem CID 121338868) has the molecular formula C24H26O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is [4-(4-methylcyclohexyl)phenyl] 4-(2-oxobut-3-enoxy)benzoate.
| Compound Name | [4-(4-methylcyclohexyl)phenyl] 4-(2-oxobut-3-enoxy)benzoate |
|---|---|
| PubChem CID | 121338868 |
| Molecular Formula | C24H26O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | [4-(4-methylcyclohexyl)phenyl] 4-(2-oxobut-3-enoxy)benzoate |
| SMILES | C=CC(=O)COc1ccc(C(=O)Oc2ccc(C3CCC(C)CC3)cc2)cc1 |
| InChI | InChI=1S/C24H26O4/c1-3-21(25)16-27-22-12-10-20(11-13-22)24(26)28-23-14-8-19(9-15-23)18-6-4-17(2)5-7-18/h3,8-15,17-18H,1,4-7,16H2,2H3 |
| InChIKey | JCPXMYKXHKBIPG-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|