C21H26O2Si — CID 123393193
[4-(silylmethyl)phenyl] 4-(4-methylcyclohexyl)benzoate (PubChem CID 123393193) has the molecular formula C21H26O2Si and a molecular weight of 338.52 g/mol. Its IUPAC name is [4-(silylmethyl)phenyl] 4-(4-methylcyclohexyl)benzoate.
| Compound Name | [4-(silylmethyl)phenyl] 4-(4-methylcyclohexyl)benzoate |
|---|---|
| PubChem CID | 123393193 |
| Molecular Formula | C21H26O2Si |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | [4-(silylmethyl)phenyl] 4-(4-methylcyclohexyl)benzoate |
| SMILES | CC1CCC(c2ccc(C(=O)Oc3ccc(C[SiH3])cc3)cc2)CC1 |
| InChI | InChI=1S/C21H26O2Si/c1-15-2-6-17(7-3-15)18-8-10-19(11-9-18)21(22)23-20-12-4-16(14-24)5-13-20/h4-5,8-13,15,17H,2-3,6-7,14H2,1,24H3 |
| InChIKey | MZEWBVOEVCFCGV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|