About [4-(2-bromoacetyl)phenyl] 4-cyclopropylbenzoate
[4-(2-bromoacetyl)phenyl] 4-cyclopropylbenzoate (PubChem CID 87652015) has the molecular formula C18H15BrO3
and a molecular weight of 359.22 g/mol. Its IUPAC name is [4-(2-bromoacetyl)phenyl] 4-cyclopropylbenzoate.
Molecular Properties
| Compound Name | [4-(2-bromoacetyl)phenyl] 4-cyclopropylbenzoate |
| PubChem CID | 87652015 |
| Molecular Formula | C18H15BrO3 |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | [4-(2-bromoacetyl)phenyl] 4-cyclopropylbenzoate |
| SMILES | O=C(CBr)c1ccc(OC(=O)c2ccc(C3CC3)cc2)cc1 |
| InChI | InChI=1S/C18H15BrO3/c19-11-17(20)14-7-9-16(10-8-14)22-18(21)15-5-3-13(4-6-15)12-1-2-12/h3-10,12H,1-2,11H2 |
| InChIKey | OWRHJIWWHKPZJF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(2-bromoacetyl)phenyl] 4-cyclopropylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-bromoacetyl)phenyl] 4-cyclopropylbenzoate?
The IUPAC name of [4-(2-bromoacetyl)phenyl] 4-cyclopropylbenzoate (CID 87652015) is [4-(2-bromoacetyl)phenyl] 4-cyclopropylbenzoate.
What is the SMILES notation for [4-(2-bromoacetyl)phenyl] 4-cyclopropylbenzoate?
The canonical SMILES for [4-(2-bromoacetyl)phenyl] 4-cyclopropylbenzoate is O=C(CBr)c1ccc(OC(=O)c2ccc(C3CC3)cc2)cc1.
What is the InChIKey of [4-(2-bromoacetyl)phenyl] 4-cyclopropylbenzoate?
The InChIKey is OWRHJIWWHKPZJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15BrO3/c19-11-17(20)14-7-9-16(10-8-14)22-18(21)15-5-3-13(4-6-15)12-1-2-12/h3-10,12H,1-2,11H2.
What are the key properties of [4-(2-bromoacetyl)phenyl] 4-cyclopropylbenzoate?
[4-(2-bromoacetyl)phenyl] 4-cyclopropylbenzoate has a molecular weight of 359.22 g/mol, XLogP of 4.36, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-bromoacetyl)phenyl] 4-cyclopropylbenzoate is sourced from PubChem (CID 87652015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).