C18H23BrO3 — CID 86634685
ethyl 2-[4-[4-(2-bromoacetyl)phenyl]cyclohexyl]acetate (PubChem CID 86634685) has the molecular formula C18H23BrO3 and a molecular weight of 367.28 g/mol. Its IUPAC name is ethyl 2-[4-[4-(2-bromoacetyl)phenyl]cyclohexyl]acetate.
| Compound Name | ethyl 2-[4-[4-(2-bromoacetyl)phenyl]cyclohexyl]acetate |
|---|---|
| PubChem CID | 86634685 |
| Molecular Formula | C18H23BrO3 |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | ethyl 2-[4-[4-(2-bromoacetyl)phenyl]cyclohexyl]acetate |
| SMILES | CCOC(=O)CC1CCC(c2ccc(C(=O)CBr)cc2)CC1 |
| InChI | InChI=1S/C18H23BrO3/c1-2-22-18(21)11-13-3-5-14(6-4-13)15-7-9-16(10-8-15)17(20)12-19/h7-10,13-14H,2-6,11-12H2,1H3 |
| InChIKey | XDVHCMOUYKHRCY-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|