C23H30N2O5 — CID 59435501
ethyl 3-[N-(2-cyanoacetyl)-4-[4-(2-methoxy-2-oxoethyl)cyclohexyl]anilino]propanoate (PubChem CID 59435501) has the molecular formula C23H30N2O5 and a molecular weight of 414.50 g/mol. Its IUPAC name is ethyl 3-[N-(2-cyanoacetyl)-4-[4-(2-methoxy-2-oxoethyl)cyclohexyl]anilino]propanoate.
| Compound Name | ethyl 3-[N-(2-cyanoacetyl)-4-[4-(2-methoxy-2-oxoethyl)cyclohexyl]anilino]propanoate |
|---|---|
| PubChem CID | 59435501 |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | ethyl 3-[N-(2-cyanoacetyl)-4-[4-(2-methoxy-2-oxoethyl)cyclohexyl]anilino]propanoate |
| SMILES | CCOC(=O)CCN(C(=O)CC#N)c1ccc(C2CCC(CC(=O)OC)CC2)cc1 |
| InChI | InChI=1S/C23H30N2O5/c1-3-30-22(27)13-15-25(21(26)12-14-24)20-10-8-19(9-11-20)18-6-4-17(5-7-18)16-23(28)29-2/h8-11,17-18H,3-7,12-13,15-16H2,1-2H3 |
| InChIKey | APFXUTZGJXJMEM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 96.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |