C33H46O4 — CID 160827399
ethyl 2-(4-phenylcyclohexyl)acetate;ethyl 2-(4-phenylcyclohexyl)propanoate (PubChem CID 160827399) has the molecular formula C33H46O4 and a molecular weight of 506.73 g/mol. Its IUPAC name is ethyl 2-(4-phenylcyclohexyl)acetate;ethyl 2-(4-phenylcyclohexyl)propanoate.
| Compound Name | ethyl 2-(4-phenylcyclohexyl)acetate;ethyl 2-(4-phenylcyclohexyl)propanoate |
|---|---|
| PubChem CID | 160827399 |
| Molecular Formula | C33H46O4 |
| Molecular Weight | 506.73 g/mol |
| Exact Mass | 506.34 |
| IUPAC Name | ethyl 2-(4-phenylcyclohexyl)acetate;ethyl 2-(4-phenylcyclohexyl)propanoate |
| SMILES | CCOC(=O)C(C)C1CCC(c2ccccc2)CC1.CCOC(=O)CC1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C17H24O2.C16H22O2/c1-3-19-17(18)13(2)14-9-11-16(12-10-14)15-7-5-4-6-8-15;1-2-18-16(17)12-13-8-10-15(11-9-13)14-6-4-3-5-7-14/h4-8,13-14,16H,3,9-12H2,1-2H3;3-7,13,15H,2,8-12H2,1H3 |
| InChIKey | SGJBFBBBXRRRFV-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.73 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |