C35H48F3NO7S — CID 167580396
ethyl 2-[4-[4-(dimethylamino)phenyl]cyclohexyl]acetate;ethyl 2-[4-[4-(trifluoromethylsulfonyloxy)phenyl]cyclohexyl]acetate (PubChem CID 167580396) has the molecular formula C35H48F3NO7S and a molecular weight of 683.83 g/mol. Its IUPAC name is ethyl 2-[4-[4-(dimethylamino)phenyl]cyclohexyl]acetate;ethyl 2-[4-[4-(trifluoromethylsulfonyloxy)phenyl]cyclohexyl]acetate.
| Compound Name | ethyl 2-[4-[4-(dimethylamino)phenyl]cyclohexyl]acetate;ethyl 2-[4-[4-(trifluoromethylsulfonyloxy)phenyl]cyclohexyl]acetate |
|---|---|
| PubChem CID | 167580396 |
| Molecular Formula | C35H48F3NO7S |
| Molecular Weight | 683.83 g/mol |
| Exact Mass | 683.31 |
| IUPAC Name | ethyl 2-[4-[4-(dimethylamino)phenyl]cyclohexyl]acetate;ethyl 2-[4-[4-(trifluoromethylsulfonyloxy)phenyl]cyclohexyl]acetate |
| SMILES | CCOC(=O)CC1CCC(c2ccc(N(C)C)cc2)CC1.CCOC(=O)CC1CCC(c2ccc(OS(=O)(=O)C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C18H27NO2.C17H21F3O5S/c1-4-21-18(20)13-14-5-7-15(8-6-14)16-9-11-17(12-10-16)19(2)3;1-2-24-16(21)11-12-3-5-13(6-4-12)14-7-9-15(10-8-14)25-26(22,23)17(18,19)20/h9-12,14-15H,4-8,13H2,1-3H3;7-10,12-13H,2-6,11H2,1H3 |
| InChIKey | HCIMXNKOGFEEBT-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.83 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|