C17H21F3O5S — CID 87131570
2-[4-[4-(trifluoromethylsulfonyloxy)phenyl]cyclohexyl]butanoic acid (PubChem CID 87131570) has the molecular formula C17H21F3O5S and a molecular weight of 394.41 g/mol. Its IUPAC name is 2-[4-[4-(trifluoromethylsulfonyloxy)phenyl]cyclohexyl]butanoic acid.
| Compound Name | 2-[4-[4-(trifluoromethylsulfonyloxy)phenyl]cyclohexyl]butanoic acid |
|---|---|
| PubChem CID | 87131570 |
| Molecular Formula | C17H21F3O5S |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 2-[4-[4-(trifluoromethylsulfonyloxy)phenyl]cyclohexyl]butanoic acid |
| SMILES | CCC(C(=O)O)C1CCC(c2ccc(OS(=O)(=O)C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C17H21F3O5S/c1-2-15(16(21)22)13-5-3-11(4-6-13)12-7-9-14(10-8-12)25-26(23,24)17(18,19)20/h7-11,13,15H,2-6H2,1H3,(H,21,22) |
| InChIKey | WTBCZMXIJNOBLH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|