C14H8F6IO6S2+ — CID 154723322
bis[4-(trifluoromethylsulfonyloxy)phenyl]iodanium (PubChem CID 154723322) has the molecular formula C14H8F6IO6S2+ and a molecular weight of 577.24 g/mol. Its IUPAC name is bis[4-(trifluoromethylsulfonyloxy)phenyl]iodanium.
| Compound Name | bis[4-(trifluoromethylsulfonyloxy)phenyl]iodanium |
|---|---|
| PubChem CID | 154723322 |
| Molecular Formula | C14H8F6IO6S2+ |
| Molecular Weight | 577.24 g/mol |
| Exact Mass | 576.87 |
| IUPAC Name | bis[4-(trifluoromethylsulfonyloxy)phenyl]iodanium |
| SMILES | O=S(=O)(Oc1ccc([I+]c2ccc(OS(=O)(=O)C(F)(F)F)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C14H8F6IO6S2/c15-13(16,17)28(22,23)26-11-5-1-9(2-6-11)21-10-3-7-12(8-4-10)27-29(24,25)14(18,19)20/h1-8H/q+1 |
| InChIKey | PKBGLSZXBKWOAM-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.24 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|