C10H9F3O6S — CID 101487578
2-hydroxy-2-[4-(trifluoromethylsulfonyloxy)phenyl]propanoic acid (PubChem CID 101487578) has the molecular formula C10H9F3O6S and a molecular weight of 314.24 g/mol. Its IUPAC name is 2-hydroxy-2-[4-(trifluoromethylsulfonyloxy)phenyl]propanoic acid.
| Compound Name | 2-hydroxy-2-[4-(trifluoromethylsulfonyloxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 101487578 |
| Molecular Formula | C10H9F3O6S |
| Molecular Weight | 314.24 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 2-hydroxy-2-[4-(trifluoromethylsulfonyloxy)phenyl]propanoic acid |
| SMILES | CC(O)(C(=O)O)c1ccc(OS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H9F3O6S/c1-9(16,8(14)15)6-2-4-7(5-3-6)19-20(17,18)10(11,12)13/h2-5,16H,1H3,(H,14,15) |
| InChIKey | QBNGBAVPLKBVFH-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.24 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|