C12H16O5 — CID 70114787
(2R)-2-hydroxy-2-[4-(2-methoxyethoxy)phenyl]propanoic acid (PubChem CID 70114787) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is (2R)-2-hydroxy-2-[4-(2-methoxyethoxy)phenyl]propanoic acid.
| Compound Name | (2R)-2-hydroxy-2-[4-(2-methoxyethoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 70114787 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | (2R)-2-hydroxy-2-[4-(2-methoxyethoxy)phenyl]propanoic acid |
| SMILES | COCCOc1ccc([C@@](C)(O)C(=O)O)cc1 |
| InChI | InChI=1S/C12H16O5/c1-12(15,11(13)14)9-3-5-10(6-4-9)17-8-7-16-2/h3-6,15H,7-8H2,1-2H3,(H,13,14)/t12-/m1/s1 |
| InChIKey | ABEVOGWDHHHUJS-GFCCVEGCSA-N |
| XLogP | 1.00 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|