C16H19F6NO10S2 — CID 87606974
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[4-(trifluoromethylsulfonyloxy)phenyl]propanoic acid;trifluoromethanesulfonic acid (PubChem CID 87606974) has the molecular formula C16H19F6NO10S2 and a molecular weight of 563.45 g/mol. Its IUPAC name is (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[4-(trifluoromethylsulfonyloxy)phenyl]propanoic acid;trifluoromethanesulfonic acid.
| Compound Name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[4-(trifluoromethylsulfonyloxy)phenyl]propanoic acid;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 87606974 |
| Molecular Formula | C16H19F6NO10S2 |
| Molecular Weight | 563.45 g/mol |
| Exact Mass | 563.04 |
| IUPAC Name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[4-(trifluoromethylsulfonyloxy)phenyl]propanoic acid;trifluoromethanesulfonic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@](C)(C(=O)O)c1ccc(OS(=O)(=O)C(F)(F)F)cc1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C15H18F3NO7S.CHF3O3S/c1-13(2,3)25-12(22)19-14(4,11(20)21)9-5-7-10(8-6-9)26-27(23,24)15(16,17)18;2-1(3,4)8(5,6)7/h5-8H,1-4H3,(H,19,22)(H,20,21);(H,5,6,7)/t14-;/m1./s1 |
| InChIKey | QKXMYLTUOVEPNV-PFEQFJNWSA-N |
| XLogP | 3.13 |
| TPSA | 173.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|