C18H27NO4 — CID 101134565
tert-butyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylpropanoate (PubChem CID 101134565) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylpropanoate.
| Compound Name | tert-butyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylpropanoate |
|---|---|
| PubChem CID | 101134565 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | tert-butyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylpropanoate |
| SMILES | CC(C)(C)OC(=O)N[C@@](C)(C(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C18H27NO4/c1-16(2,3)22-14(20)18(7,13-11-9-8-10-12-13)19-15(21)23-17(4,5)6/h8-12H,1-7H3,(H,19,21)/t18-/m1/s1 |
| InChIKey | ARKAYRYERZTHBP-GOSISDBHSA-N |
| XLogP | 3.77 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |