C16H25N3O4 — CID 155819932
acetic acid;tert-butyl N-(1-amino-1-imino-2-phenylpropan-2-yl)carbamate (PubChem CID 155819932) has the molecular formula C16H25N3O4 and a molecular weight of 323.39 g/mol. Its IUPAC name is acetic acid;tert-butyl N-(1-amino-1-imino-2-phenylpropan-2-yl)carbamate.
| Compound Name | acetic acid;tert-butyl N-(1-amino-1-imino-2-phenylpropan-2-yl)carbamate |
|---|---|
| PubChem CID | 155819932 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | acetic acid;tert-butyl N-(1-amino-1-imino-2-phenylpropan-2-yl)carbamate |
| SMILES | CC(=O)O.[H]/N=C(\N)C(C)(NC(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C14H21N3O2.C2H4O2/c1-13(2,3)19-12(18)17-14(4,11(15)16)10-8-6-5-7-9-10;1-2(3)4/h5-9H,1-4H3,(H3,15,16)(H,17,18);1H3,(H,3,4) |
| InChIKey | OSTHASRPCLPPOZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 125.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|