C15H24NO5P — CID 122225403
tert-butyl N-[(1R)-1-dimethoxyphosphoryl-1-phenylethyl]carbamate (PubChem CID 122225403) has the molecular formula C15H24NO5P and a molecular weight of 329.33 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-dimethoxyphosphoryl-1-phenylethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-dimethoxyphosphoryl-1-phenylethyl]carbamate |
|---|---|
| PubChem CID | 122225403 |
| Molecular Formula | C15H24NO5P |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | tert-butyl N-[(1R)-1-dimethoxyphosphoryl-1-phenylethyl]carbamate |
| SMILES | COP(=O)(OC)[C@@](C)(NC(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C15H24NO5P/c1-14(2,3)21-13(17)16-15(4,22(18,19-5)20-6)12-10-8-7-9-11-12/h7-11H,1-6H3,(H,16,17)/t15-/m1/s1 |
| InChIKey | WMTDGWQKLMQVGU-OAHLLOKOSA-N |
| XLogP | 3.87 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|