About tert-butyl N-diphenylphosphoryloxycarbamate
tert-butyl N-diphenylphosphoryloxycarbamate (PubChem CID 139070667) has the molecular formula C51H60N3O12P3
and a molecular weight of 999.97 g/mol. Its IUPAC name is tert-butyl N-diphenylphosphoryloxycarbamate.
Molecular Properties
| Compound Name | tert-butyl N-diphenylphosphoryloxycarbamate |
| PubChem CID | 139070667 |
| Molecular Formula | C51H60N3O12P3 |
| Molecular Weight | 999.97 g/mol |
| Exact Mass | 999.34 |
| IUPAC Name | tert-butyl N-diphenylphosphoryloxycarbamate |
| SMILES | CC(C)(C)OC(=O)NOP(=O)(c1ccccc1)c1ccccc1.CC(C)(C)OC(=O)NOP(=O)(c1ccccc1)c1ccccc1.CC(C)(C)OC(=O)NOP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/3C17H20NO4P/c3*1-17(2,3)21-16(19)18-22-23(20,14-10-6-4-7-11-14)15-12-8-5-9-13-15/h3*4-13H,1-3H3,(H,18,19) |
| InChIKey | NXKIBCKDAGFLDO-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 193.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 69 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 999.97 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-diphenylphosphoryloxycarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-diphenylphosphoryloxycarbamate?
The IUPAC name of tert-butyl N-diphenylphosphoryloxycarbamate (CID 139070667) is tert-butyl N-diphenylphosphoryloxycarbamate.
What is the SMILES notation for tert-butyl N-diphenylphosphoryloxycarbamate?
The canonical SMILES for tert-butyl N-diphenylphosphoryloxycarbamate is CC(C)(C)OC(=O)NOP(=O)(c1ccccc1)c1ccccc1.CC(C)(C)OC(=O)NOP(=O)(c1ccccc1)c1ccccc1.CC(C)(C)OC(=O)NOP(=O)(c1ccccc1)c1ccccc1.
What is the InChIKey of tert-butyl N-diphenylphosphoryloxycarbamate?
The InChIKey is NXKIBCKDAGFLDO-UHFFFAOYSA-N. The full InChI is InChI=1S/3C17H20NO4P/c3*1-17(2,3)21-16(19)18-22-23(20,14-10-6-4-7-11-14)15-12-8-5-9-13-15/h3*4-13H,1-3H3,(H,18,19).
What are the key properties of tert-butyl N-diphenylphosphoryloxycarbamate?
tert-butyl N-diphenylphosphoryloxycarbamate has a molecular weight of 999.97 g/mol, XLogP of 10.12, 12 rotatable bonds, 3 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-diphenylphosphoryloxycarbamate is sourced from PubChem (CID 139070667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).