C26H29N2O3P — CID 23232898
tert-butyl N-[(2S)-1-diphenylphosphorylimino-1-phenylpropan-2-yl]carbamate (PubChem CID 23232898) has the molecular formula C26H29N2O3P and a molecular weight of 448.50 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-diphenylphosphorylimino-1-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-diphenylphosphorylimino-1-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 23232898 |
| Molecular Formula | C26H29N2O3P |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | tert-butyl N-[(2S)-1-diphenylphosphorylimino-1-phenylpropan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)C(=NP(=O)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H29N2O3P/c1-20(27-25(29)31-26(2,3)4)24(21-14-8-5-9-15-21)28-32(30,22-16-10-6-11-17-22)23-18-12-7-13-19-23/h5-20H,1-4H3,(H,27,29)/t20-/m0/s1 |
| InChIKey | GXCHAUJRMFUBEJ-FQEVSTJZSA-N |
| XLogP | 5.32 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|