C27H29NO3S — CID 175818021
S-trityl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanethioate (PubChem CID 175818021) has the molecular formula C27H29NO3S and a molecular weight of 447.60 g/mol. Its IUPAC name is S-trityl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanethioate.
| Compound Name | S-trityl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanethioate |
|---|---|
| PubChem CID | 175818021 |
| Molecular Formula | C27H29NO3S |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | S-trityl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanethioate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)C(=O)SC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H29NO3S/c1-20(28-25(30)31-26(2,3)4)24(29)32-27(21-14-8-5-9-15-21,22-16-10-6-11-17-22)23-18-12-7-13-19-23/h5-20H,1-4H3,(H,28,30)/t20-/m0/s1 |
| InChIKey | ULYDRFRZMQNKKW-FQEVSTJZSA-N |
| XLogP | 6.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|